ballerkay10 ballerkay10

16-12-2022
Mathematics

contestada

In square QRST, ST = 8x + 9 and QR = 73, what is x?

Respuesta :

Otras preguntas

When jane, a customer of kk kids store, makes a purchase and shares valuable information about the products of the store through her facebook posts, the type of

Your backpack contains 2010 chocolate bars, which you are going to divide between your best friend and yourself. You think you are a nice person, so you will g

Answer Please will rate and more!!!!!!!!!!!!!!!!!!!!!!!!!!

What type of economy was the basis of the industrial revolution?

Which compound has the highest melting point? ch3(ch2)14cooh ch3(ch2)10ch=ch(ch2)2cooh ch3(ch2)2ch=ch(ch2)4ch=ch(ch2)4cooh ch3(ch2)2ch=ch(ch2)2ch=ch(ch2)2ch=ch(

The population of Newton was 79,760 people when Sarah moved there. Currently it is 5% larger. What is the current population

100 points help please fast

what is the y intercept of y=2x+3

Which structure is responsible for storing bile? why is bile important?

What industrial weakness signaled a declining economy in the 1920s?